Jump To:
loading...| Preferred Name |
phenylalanine |
| Synonyms |
fenilalanina 2-amino-3-phenylpropanoic acid Phenylalanine Phenylalanin alpha-Amino-beta-phenylpropionic acid C9H11NO2 |
| ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
| database_cross_reference |
ChemIDplus:150-30-1 SNOMEDCT:421626005 Gmelin:50836 KEGG COMPOUND:C02057 NCIt:C29601 Beilstein:1910407 SNOMEDCT:63004003 NIST Chemistry WebBook:150-30-1 MSH:D010649 |
| gwas_trait |
true |
| has_exact_synonym |
fenilalanina 2-amino-3-phenylpropanoic acid Phenylalanine Phenylalanin alpha-Amino-beta-phenylpropionic acid C9H11NO2 |
| InChI |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| InChIKey |
InChIKey=COLNVLDHVKWLRT-UHFFFAOYSA-N |
| label |
phenylalanine |
| prefixIRI |
CHEBI:28044 |
| prefLabel |
phenylalanine |
| SMILES |
NC(Cc1ccccc1)C(O)=O |
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create New Mapping
Create New External Mapping
Internal mappings
Interportal mappings
| Delete | Mapping To | Ontology | Source | Relations |
|---|---|---|---|---|
| There are currently no interportal mappings for this class. | ||||
External mappings
| Delete | Mapping To | Ontology | Source | Relations |
|---|---|---|---|---|
| There are currently no external mappings for this class. | ||||
loading... loading... loading... loading... loading...