loading...| Preferred Name |
methionine |
| Synonyms |
Methionin methionine Racemethionine 2-amino-4-(methylsulfanyl)butanoic acid Hmet Methionine 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid M Met C5H11NO2S metionina DL-Methionine 2-amino-4-(methylthio)butanoic acid |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
| database_cross_reference |
CiteXplore:16702333 KEGG DRUG:D04983 MSH:D008715 Beilstein:636185 NIST Chemistry WebBook:59-51-8 UM-BBD:c0094 KEGG COMPOUND:C01733 Reaxys:636185 Gmelin:3117 NCIt:C29600 ChemIDplus:59-51-8 SNOMEDCT:70288006 Wikipedia:Methionine |
| has_exact_synonym |
Methionin methionine Racemethionine 2-amino-4-(methylsulfanyl)butanoic acid Hmet Methionine 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid M Met C5H11NO2S metionina DL-Methionine 2-amino-4-(methylthio)butanoic acid |
| has_role | |
| InChI |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey |
InChIKey=FFEARJCKVFRZRR-UHFFFAOYSA-N |
| label |
methionine |
| prefixIRI |
CHEBI:16811 |
| prefLabel |
methionine |
| SMILES |
CSCCC(N)C(O)=O |
| term editor |
Class imported / merged by efoimporter |
| subClassOf |
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Internal mappings
Interportal mappings
| Delete | Mapping To | Ontology | Source | Relations |
|---|---|---|---|---|
| There are currently no interportal mappings for this class. | ||||
External mappings
| Delete | Mapping To | Ontology | Source | Relations |
|---|---|---|---|---|
| There are currently no external mappings for this class. | ||||
loading... loading... loading... loading... loading...